C19H27N5O3 — CID 18407597
2-[4-[[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2,6-dimethylpiperazin-1-yl]acetic acid (PubChem CID 18407597) has the molecular formula C19H27N5O3 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[4-[[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2,6-dimethylpiperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2,6-dimethylpiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18407597 |
| Molecular Formula | C19H27N5O3 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | 2-[4-[[3-(4-carbamimidoylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl]-2,6-dimethylpiperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C2=NOC(CN3CC(C)N(CC(=O)O)C(C)C3)C2)cc1 |
| InChI | InChI=1S/C19H27N5O3/c1-12-8-23(9-13(2)24(12)11-18(25)26)10-16-7-17(22-27-16)14-3-5-15(6-4-14)19(20)21/h3-6,12-13,16H,7-11H2,1-2H3,(H3,20,21)(H,25,26) |
| InChIKey | PUGSHZRXWAMITC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|