C22H30N4O3 — CID 18407607
2-[4-[[3-[4-(N'-butylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methylidene]piperidin-1-yl]acetic acid (PubChem CID 18407607) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[4-[[3-[4-(N'-butylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methylidene]piperidin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-(N'-butylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methylidene]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18407607 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 2-[4-[[3-[4-(N'-butylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methylidene]piperidin-1-yl]acetic acid |
| SMILES | CCCC/N=C(\N)c1ccc(C2=NOC(C=C3CCN(CC(=O)O)CC3)C2)cc1 |
| InChI | InChI=1S/C22H30N4O3/c1-2-3-10-24-22(23)18-6-4-17(5-7-18)20-14-19(29-25-20)13-16-8-11-26(12-9-16)15-21(27)28/h4-7,13,19H,2-3,8-12,14-15H2,1H3,(H2,23,24)(H,27,28) |
| InChIKey | BACKNJOZHJKUKI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|