C20H29N5O3 — CID 18407608
2-[4-[[3-[4-(N-ethyl-N-methylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid (PubChem CID 18407608) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[4-[[3-[4-(N-ethyl-N-methylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[[3-[4-(N-ethyl-N-methylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 18407608 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 2-[4-[[3-[4-(N-ethyl-N-methylcarbamimidoyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]methyl]piperazin-1-yl]acetic acid |
| SMILES | [H]/N=C(/c1ccc(C2=NOC(CN3CCN(CC(=O)O)CC3)C2)cc1)N(C)CC |
| InChI | InChI=1S/C20H29N5O3/c1-3-23(2)20(21)16-6-4-15(5-7-16)18-12-17(28-22-18)13-24-8-10-25(11-9-24)14-19(26)27/h4-7,17,21H,3,8-14H2,1-2H3,(H,26,27)/b21-20- |
| InChIKey | ROKRFHWOKPLLJK-MRCUWXFGSA-N |
| XLogP | 1.16 |
| TPSA | 92.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|