About 1,3,4-trimethyl-2H-imidazole
1,3,4-trimethyl-2H-imidazole (PubChem CID 18407944) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 1,3,4-trimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 1,3,4-trimethyl-2H-imidazole |
| PubChem CID | 18407944 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1,3,4-trimethyl-2H-imidazole |
| SMILES | CC1=CN(C)CN1C |
| InChI | InChI=1S/C6H12N2/c1-6-4-7(2)5-8(6)3/h4H,5H2,1-3H3 |
| InChIKey | KTWCNPBNIFBZCY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3,4-trimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,4-trimethyl-2H-imidazole?
The IUPAC name of 1,3,4-trimethyl-2H-imidazole (CID 18407944) is 1,3,4-trimethyl-2H-imidazole.
What is the SMILES notation for 1,3,4-trimethyl-2H-imidazole?
The canonical SMILES for 1,3,4-trimethyl-2H-imidazole is CC1=CN(C)CN1C.
What is the InChIKey of 1,3,4-trimethyl-2H-imidazole?
The InChIKey is KTWCNPBNIFBZCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-6-4-7(2)5-8(6)3/h4H,5H2,1-3H3.
What are the key properties of 1,3,4-trimethyl-2H-imidazole?
1,3,4-trimethyl-2H-imidazole has a molecular weight of 112.18 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,4-trimethyl-2H-imidazole is sourced from PubChem (CID 18407944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).