2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid

C10H14N2O5 — CID 18408269

IUPAC2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid
SMILESCCCC(C)C1(C(=O)O)C(=O)NC(=O)NC1=O
InChIInChI=1S/C10H14N2O5/c1-3-4-5(2)10(8(15)16)6(13)11-9(17)12-7(10)14/h5H,3-4H2,1-2H3,(H,15,16)(H2,11,12,13,14,17)
InChIKeyPCAGHCADOYLDJY-UHFFFAOYSA-N
MW242.23 g/mol
LogP-0.14
Rot. Bonds4

About 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid

2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid (PubChem CID 18408269) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid.

Molecular Properties

Compound Name2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid
PubChem CID18408269
Molecular FormulaC10H14N2O5
Molecular Weight242.23 g/mol
Exact Mass242.09
IUPAC Name2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid
SMILESCCCC(C)C1(C(=O)O)C(=O)NC(=O)NC1=O
InChIInChI=1S/C10H14N2O5/c1-3-4-5(2)10(8(15)16)6(13)11-9(17)12-7(10)14/h5H,3-4H2,1-2H3,(H,15,16)(H2,11,12,13,14,17)
InChIKeyPCAGHCADOYLDJY-UHFFFAOYSA-N
XLogP-0.14
TPSA112.57 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.23
LogP ≤ 5-0.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid?
The IUPAC name of 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid (CID 18408269) is 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid.
What is the SMILES notation for 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid?
The canonical SMILES for 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid is CCCC(C)C1(C(=O)O)C(=O)NC(=O)NC1=O.
What is the InChIKey of 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid?
The InChIKey is PCAGHCADOYLDJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O5/c1-3-4-5(2)10(8(15)16)6(13)11-9(17)12-7(10)14/h5H,3-4H2,1-2H3,(H,15,16)(H2,11,12,13,14,17).
What are the key properties of 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid?
2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid has a molecular weight of 242.23 g/mol, XLogP of -0.14, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trioxo-5-pentan-2-yl-1,3-diazinane-5-carboxylic acid is sourced from PubChem (CID 18408269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).