C35H48N6O8 — CID 18408489
1,4-bis[[1-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl]methyl]-1,4-diazepane (PubChem CID 18408489) has the molecular formula C35H48N6O8 and a molecular weight of 680.80 g/mol. Its IUPAC name is 1,4-bis[[1-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl]methyl]-1,4-diazepane.
| Compound Name | 1,4-bis[[1-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 18408489 |
| Molecular Formula | C35H48N6O8 |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.35 |
| IUPAC Name | 1,4-bis[[1-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)pyrazol-3-yl]methyl]-1,4-diazepane |
| SMILES | COCn1nc(CN2CCCN(Cc3cc(-c4cc(OC)c(OC)c(OC)c4)n(COC)n3)CC2)cc1-c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C35H48N6O8/c1-42-22-40-28(24-14-30(44-3)34(48-7)31(15-24)45-4)18-26(36-40)20-38-10-9-11-39(13-12-38)21-27-19-29(41(37-27)23-43-2)25-16-32(46-5)35(49-8)33(17-25)47-6/h14-19H,9-13,20-23H2,1-8H3 |
| InChIKey | MIPJWCHMHUJJHP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 115.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |