C24H17N3O4 — CID 18408786
N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)-9H-fluorene-1-carboxamide (PubChem CID 18408786) has the molecular formula C24H17N3O4 and a molecular weight of 411.42 g/mol. Its IUPAC name is N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)-9H-fluorene-1-carboxamide.
| Compound Name | N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)-9H-fluorene-1-carboxamide |
|---|---|
| PubChem CID | 18408786 |
| Molecular Formula | C24H17N3O4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-(2,4,6-trioxo-5-phenyl-1,3-diazinan-5-yl)-9H-fluorene-1-carboxamide |
| SMILES | O=C1NC(=O)C(NC(=O)c2cccc3c2Cc2ccccc2-3)(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C24H17N3O4/c28-20(18-12-6-11-17-16-10-5-4-7-14(16)13-19(17)18)27-24(15-8-2-1-3-9-15)21(29)25-23(31)26-22(24)30/h1-12H,13H2,(H,27,28)(H2,25,26,29,30,31) |
| InChIKey | JUJRYBUJPBGLTE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|