C16H30N5O4+ — CID 18408810
5-(6-aminohexyl)-5-[1-(2-hydroxyethyl)piperazin-1-ium-1-yl]-1,3-diazinane-2,4,6-trione (PubChem CID 18408810) has the molecular formula C16H30N5O4+ and a molecular weight of 356.45 g/mol. Its IUPAC name is 5-(6-aminohexyl)-5-[1-(2-hydroxyethyl)piperazin-1-ium-1-yl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(6-aminohexyl)-5-[1-(2-hydroxyethyl)piperazin-1-ium-1-yl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 18408810 |
| Molecular Formula | C16H30N5O4+ |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 5-(6-aminohexyl)-5-[1-(2-hydroxyethyl)piperazin-1-ium-1-yl]-1,3-diazinane-2,4,6-trione |
| SMILES | NCCCCCCC1([N+]2(CCO)CCNCC2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C16H29N5O4/c17-6-4-2-1-3-5-16(13(23)19-15(25)20-14(16)24)21(11-12-22)9-7-18-8-10-21/h18,22H,1-12,17H2,(H-,19,20,23,24,25)/p+1 |
| InChIKey | JOQMZAZEWNKMAG-UHFFFAOYSA-O |
| XLogP | -1.59 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|