C31H31F3N2O2S2 — CID 18409224
9-[6-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]hexyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18409224) has the molecular formula C31H31F3N2O2S2 and a molecular weight of 584.73 g/mol. Its IUPAC name is 9-[6-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]hexyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[6-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]hexyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18409224 |
| Molecular Formula | C31H31F3N2O2S2 |
| Molecular Weight | 584.73 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | 9-[6-[(6-ethoxy-1,3-benzothiazol-2-yl)sulfanyl]hexyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | CCOc1ccc2nc(SCCCCCCC3(C(=O)NCC(F)(F)F)c4ccccc4-c4ccccc43)sc2c1 |
| InChI | InChI=1S/C31H31F3N2O2S2/c1-2-38-21-15-16-26-27(19-21)40-29(36-26)39-18-10-4-3-9-17-30(28(37)35-20-31(32,33)34)24-13-7-5-11-22(24)23-12-6-8-14-25(23)30/h5-8,11-16,19H,2-4,9-10,17-18,20H2,1H3,(H,35,37) |
| InChIKey | SMSWGHDCDWQVFE-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.73 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|