C36H31F3N4O3 — CID 18409244
9-[4-[4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18409244) has the molecular formula C36H31F3N4O3 and a molecular weight of 624.66 g/mol. Its IUPAC name is 9-[4-[4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18409244 |
| Molecular Formula | C36H31F3N4O3 |
| Molecular Weight | 624.66 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | 9-[4-[4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(Nc1cn(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)cn1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C36H31F3N4O3/c37-36(38,39)23-40-34(45)35(29-17-7-4-14-26(29)27-15-5-8-18-30(27)35)20-10-11-21-43-22-32(41-24-43)42-33(44)28-16-6-9-19-31(28)46-25-12-2-1-3-13-25/h1-9,12-19,22,24H,10-11,20-21,23H2,(H,40,45)(H,42,44) |
| InChIKey | HJRPBYUBIAQMFX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.66 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|