C37H33F3N4O3 — CID 18409246
9-[4-[2-methyl-4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18409246) has the molecular formula C37H33F3N4O3 and a molecular weight of 638.69 g/mol. Its IUPAC name is 9-[4-[2-methyl-4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[4-[2-methyl-4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18409246 |
| Molecular Formula | C37H33F3N4O3 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.25 |
| IUPAC Name | 9-[4-[2-methyl-4-[(2-phenoxybenzoyl)amino]imidazol-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | Cc1nc(NC(=O)c2ccccc2Oc2ccccc2)cn1CCCCC1(C(=O)NCC(F)(F)F)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H33F3N4O3/c1-25-42-33(43-34(45)29-17-7-10-20-32(29)47-26-13-3-2-4-14-26)23-44(25)22-12-11-21-36(35(46)41-24-37(38,39)40)30-18-8-5-15-27(30)28-16-6-9-19-31(28)36/h2-10,13-20,23H,11-12,21-22,24H2,1H3,(H,41,46)(H,43,45) |
| InChIKey | ZMFPHVKULRWMOF-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|