C31H25Cl2F3N4O2 — CID 18409304
9-[3-[[6-[(2,5-dichlorobenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide (PubChem CID 18409304) has the molecular formula C31H25Cl2F3N4O2 and a molecular weight of 613.47 g/mol. Its IUPAC name is 9-[3-[[6-[(2,5-dichlorobenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide.
| Compound Name | 9-[3-[[6-[(2,5-dichlorobenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
|---|---|
| PubChem CID | 18409304 |
| Molecular Formula | C31H25Cl2F3N4O2 |
| Molecular Weight | 613.47 g/mol |
| Exact Mass | 612.13 |
| IUPAC Name | 9-[3-[[6-[(2,5-dichlorobenzoyl)amino]-3-pyridinyl]amino]propyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide |
| SMILES | O=C(Nc1ccc(NCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)cn1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C31H25Cl2F3N4O2/c32-19-10-12-26(33)23(16-19)28(41)40-27-13-11-20(17-38-27)37-15-5-14-30(29(42)39-18-31(34,35)36)24-8-3-1-6-21(24)22-7-2-4-9-25(22)30/h1-4,6-13,16-17,37H,5,14-15,18H2,(H,39,42)(H,38,40,41) |
| InChIKey | RDERBDSAZQNESG-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.47 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|