C6H4F7NOS — CID 18409433
2,2,3,3,4,4,4-heptafluoro-N-(2-sulfanylideneethyl)butanamide (PubChem CID 18409433) has the molecular formula C6H4F7NOS and a molecular weight of 271.16 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-N-(2-sulfanylideneethyl)butanamide.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-sulfanylideneethyl)butanamide |
|---|---|
| PubChem CID | 18409433 |
| Molecular Formula | C6H4F7NOS |
| Molecular Weight | 271.16 g/mol |
| Exact Mass | 270.99 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-N-(2-sulfanylideneethyl)butanamide |
| SMILES | O=C(NCC=S)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H4F7NOS/c7-4(8,3(15)14-1-2-16)5(9,10)6(11,12)13/h2H,1H2,(H,14,15) |
| InChIKey | FIOWYSCKBCKRSV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.16 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|