About 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane
2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane (PubChem CID 18410072) has the molecular formula C7H10S2Se2
and a molecular weight of 316.21 g/mol. Its IUPAC name is 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane.
Molecular Properties
| Compound Name | 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane |
| PubChem CID | 18410072 |
| Molecular Formula | C7H10S2Se2 |
| Molecular Weight | 316.21 g/mol |
| Exact Mass | 317.86 |
| IUPAC Name | 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane |
| SMILES | C1SC1C1C[Se]C(C2CS2)[Se]1 |
| InChI | InChI=1S/C7H10S2Se2/c1-4(8-1)6-3-10-7(11-6)5-2-9-5/h4-7H,1-3H2 |
| InChIKey | DJBOFILTHKVFLU-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane?
The IUPAC name of 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane (CID 18410072) is 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane.
What is the SMILES notation for 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane?
The canonical SMILES for 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane is C1SC1C1C[Se]C(C2CS2)[Se]1.
What is the InChIKey of 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane?
The InChIKey is DJBOFILTHKVFLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10S2Se2/c1-4(8-1)6-3-10-7(11-6)5-2-9-5/h4-7H,1-3H2.
What are the key properties of 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane?
2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane has a molecular weight of 316.21 g/mol, XLogP of 1.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(thiiran-2-yl)-1,3-diselenolan-4-yl]thiirane is sourced from PubChem (CID 18410072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).