C11H19NO6 — CID 18411425
2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanedioic acid (PubChem CID 18411425) has the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. Its IUPAC name is 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18411425 |
| Molecular Formula | C11H19NO6 |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | 2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]pentanedioic acid |
| SMILES | CC(C)(C)OC(=O)CNC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19NO6/c1-11(2,3)18-9(15)6-12-7(10(16)17)4-5-8(13)14/h7,12H,4-6H2,1-3H3,(H,13,14)(H,16,17) |
| InChIKey | WYJKSFYPCPXIMB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |