About 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate
2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 18412221) has the molecular formula C25H23Cl2N3O3
and a molecular weight of 484.38 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 18412221 |
| Molecular Formula | C25H23Cl2N3O3 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCCN1CCOCC1)c1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1 |
| InChI | InChI=1S/C25H23Cl2N3O3/c26-18-5-6-21(27)17(13-18)16-30-23-4-2-1-3-19(23)20-14-22(28-15-24(20)30)25(31)33-12-9-29-7-10-32-11-8-29/h1-6,13-15H,7-12,16H2 |
| InChIKey | NBJUYFQYVNMNCU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (CID 18412221) is 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate is O=C(OCCN1CCOCC1)c1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1.
What is the InChIKey of 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is NBJUYFQYVNMNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23Cl2N3O3/c26-18-5-6-21(27)17(13-18)16-30-23-4-2-1-3-19(23)20-14-22(28-15-24(20)30)25(31)33-12-9-29-7-10-32-11-8-29/h1-6,13-15H,7-12,16H2.
What are the key properties of 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate?
2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 484.38 g/mol, XLogP of 5.03, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-morpholin-4-ylethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 18412221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).