C25H19Cl2N3O4 — CID 18412231
2-(2,5-dioxopyrrolidin-1-yl)ethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate (PubChem CID 18412231) has the molecular formula C25H19Cl2N3O4 and a molecular weight of 496.35 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)ethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 18412231 |
| Molecular Formula | C25H19Cl2N3O4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)ethyl 9-[(2,5-dichlorophenyl)methyl]pyrido[3,4-b]indole-3-carboxylate |
| SMILES | O=C(OCCN1C(=O)CCC1=O)c1cc2c3ccccc3n(Cc3cc(Cl)ccc3Cl)c2cn1 |
| InChI | InChI=1S/C25H19Cl2N3O4/c26-16-5-6-19(27)15(11-16)14-30-21-4-2-1-3-17(21)18-12-20(28-13-22(18)30)25(33)34-10-9-29-23(31)7-8-24(29)32/h1-6,11-13H,7-10,14H2 |
| InChIKey | JQFMMDHUOGUCFL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|