About ethyl 3-amino-4-fluorobenzoate
ethyl 3-amino-4-fluorobenzoate (PubChem CID 18412404) has the molecular formula C9H10FNO2
and a molecular weight of 183.18 g/mol. Its IUPAC name is ethyl 3-amino-4-fluorobenzoate.
Molecular Properties
| Compound Name | ethyl 3-amino-4-fluorobenzoate |
| PubChem CID | 18412404 |
| Molecular Formula | C9H10FNO2 |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | ethyl 3-amino-4-fluorobenzoate |
| SMILES | CCOC(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C9H10FNO2/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2,11H2,1H3 |
| InChIKey | XRJOTWKQZHOXTM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-amino-4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-4-fluorobenzoate?
The IUPAC name of ethyl 3-amino-4-fluorobenzoate (CID 18412404) is ethyl 3-amino-4-fluorobenzoate.
What is the SMILES notation for ethyl 3-amino-4-fluorobenzoate?
The canonical SMILES for ethyl 3-amino-4-fluorobenzoate is CCOC(=O)c1ccc(F)c(N)c1.
What is the InChIKey of ethyl 3-amino-4-fluorobenzoate?
The InChIKey is XRJOTWKQZHOXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2/c1-2-13-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2,11H2,1H3.
What are the key properties of ethyl 3-amino-4-fluorobenzoate?
ethyl 3-amino-4-fluorobenzoate has a molecular weight of 183.18 g/mol, XLogP of 1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-4-fluorobenzoate is sourced from PubChem (CID 18412404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).