About 5-(methylamino)benzene-1,2,3-triol
5-(methylamino)benzene-1,2,3-triol (PubChem CID 18412870) has the molecular formula C7H9NO3
and a molecular weight of 155.15 g/mol. Its IUPAC name is 5-(methylamino)benzene-1,2,3-triol.
Molecular Properties
| Compound Name | 5-(methylamino)benzene-1,2,3-triol |
| PubChem CID | 18412870 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 5-(methylamino)benzene-1,2,3-triol |
| SMILES | CNc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C7H9NO3/c1-8-4-2-5(9)7(11)6(10)3-4/h2-3,8-11H,1H3 |
| InChIKey | NYDBLQUTSMVHKJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 5-(methylamino)benzene-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methylamino)benzene-1,2,3-triol?
The IUPAC name of 5-(methylamino)benzene-1,2,3-triol (CID 18412870) is 5-(methylamino)benzene-1,2,3-triol.
What is the SMILES notation for 5-(methylamino)benzene-1,2,3-triol?
The canonical SMILES for 5-(methylamino)benzene-1,2,3-triol is CNc1cc(O)c(O)c(O)c1.
What is the InChIKey of 5-(methylamino)benzene-1,2,3-triol?
The InChIKey is NYDBLQUTSMVHKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3/c1-8-4-2-5(9)7(11)6(10)3-4/h2-3,8-11H,1H3.
What are the key properties of 5-(methylamino)benzene-1,2,3-triol?
5-(methylamino)benzene-1,2,3-triol has a molecular weight of 155.15 g/mol, XLogP of 0.85, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methylamino)benzene-1,2,3-triol is sourced from PubChem (CID 18412870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).