About 2-naphthalen-1-yloxetane
2-naphthalen-1-yloxetane (PubChem CID 18412934) has the molecular formula C13H12O
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-naphthalen-1-yloxetane.
Molecular Properties
| Compound Name | 2-naphthalen-1-yloxetane |
| PubChem CID | 18412934 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 2-naphthalen-1-yloxetane |
| SMILES | c1ccc2c(C3CCO3)cccc2c1 |
| InChI | InChI=1S/C13H12O/c1-2-6-11-10(4-1)5-3-7-12(11)13-8-9-14-13/h1-7,13H,8-9H2 |
| InChIKey | XBMPCXFKGZYROD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-naphthalen-1-yloxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-yloxetane?
The IUPAC name of 2-naphthalen-1-yloxetane (CID 18412934) is 2-naphthalen-1-yloxetane.
What is the SMILES notation for 2-naphthalen-1-yloxetane?
The canonical SMILES for 2-naphthalen-1-yloxetane is c1ccc2c(C3CCO3)cccc2c1.
What is the InChIKey of 2-naphthalen-1-yloxetane?
The InChIKey is XBMPCXFKGZYROD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O/c1-2-6-11-10(4-1)5-3-7-12(11)13-8-9-14-13/h1-7,13H,8-9H2.
What are the key properties of 2-naphthalen-1-yloxetane?
2-naphthalen-1-yloxetane has a molecular weight of 184.24 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-yloxetane is sourced from PubChem (CID 18412934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).