About 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate
1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate (PubChem CID 18413220) has the molecular formula C11H10ClNO6
and a molecular weight of 287.66 g/mol. Its IUPAC name is 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate.
Molecular Properties
| Compound Name | 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate |
| PubChem CID | 18413220 |
| Molecular Formula | C11H10ClNO6 |
| Molecular Weight | 287.66 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate |
| SMILES | COC(=O)C(C)C(=O)Oc1cccc(Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10ClNO6/c1-6(10(14)18-2)11(15)19-8-5-3-4-7(12)9(8)13(16)17/h3-6H,1-2H3 |
| InChIKey | UVYHTOPJPCBQJF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.66 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate?
The IUPAC name of 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate (CID 18413220) is 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate.
What is the SMILES notation for 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate?
The canonical SMILES for 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate is COC(=O)C(C)C(=O)Oc1cccc(Cl)c1[N+](=O)[O-].
What is the InChIKey of 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate?
The InChIKey is UVYHTOPJPCBQJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10ClNO6/c1-6(10(14)18-2)11(15)19-8-5-3-4-7(12)9(8)13(16)17/h3-6H,1-2H3.
What are the key properties of 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate?
1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate has a molecular weight of 287.66 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(3-chloro-2-nitrophenyl) 3-O-methyl 2-methylpropanedioate is sourced from PubChem (CID 18413220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).