About 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide
1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide (PubChem CID 18413427) has the molecular formula C13H18BrN5O2S
and a molecular weight of 388.29 g/mol. Its IUPAC name is 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide.
Molecular Properties
| Compound Name | 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide |
| PubChem CID | 18413427 |
| Molecular Formula | C13H18BrN5O2S |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide |
| SMILES | CSc1cc(N)c([N+](=O)[O-])cc1NCCn1ccc[n+]1C.[Br-] |
| InChI | InChI=1S/C13H18N5O2S.BrH/c1-16-5-3-6-17(16)7-4-15-11-9-12(18(19)20)10(14)8-13(11)21-2;/h3,5-6,8-9,15H,4,7,14H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | QMYCKBYIXCOXIZ-UHFFFAOYSA-M |
| XLogP | -1.36 |
| TPSA | 90.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide?
The IUPAC name of 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide (CID 18413427) is 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide.
What is the SMILES notation for 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide?
The canonical SMILES for 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide is CSc1cc(N)c([N+](=O)[O-])cc1NCCn1ccc[n+]1C.[Br-].
What is the InChIKey of 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide?
The InChIKey is QMYCKBYIXCOXIZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C13H18N5O2S.BrH/c1-16-5-3-6-17(16)7-4-15-11-9-12(18(19)20)10(14)8-13(11)21-2;/h3,5-6,8-9,15H,4,7,14H2,1-2H3;1H/q+1;/p-1.
What are the key properties of 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide?
1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide has a molecular weight of 388.29 g/mol, XLogP of -1.36, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[2-(2-methylpyrazol-2-ium-1-yl)ethyl]-2-methylsulfanyl-5-nitrobenzene-1,4-diamine bromide is sourced from PubChem (CID 18413427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).