About 2-aminoethanesulfonate;tetrabutylazanium
2-aminoethanesulfonate;tetrabutylazanium (PubChem CID 18413528) has the molecular formula C18H42N2O3S
and a molecular weight of 366.61 g/mol. Its IUPAC name is 2-aminoethanesulfonate;tetrabutylazanium.
Molecular Properties
| Compound Name | 2-aminoethanesulfonate;tetrabutylazanium |
| PubChem CID | 18413528 |
| Molecular Formula | C18H42N2O3S |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | 2-aminoethanesulfonate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C16H36N.C2H7NO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;3-1-2-7(4,5)6/h5-16H2,1-4H3;1-3H2,(H,4,5,6)/q+1;/p-1 |
| InChIKey | YWLHQBNWPCKZSB-UHFFFAOYSA-M |
| XLogP | 3.49 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethanesulfonate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethanesulfonate;tetrabutylazanium?
The IUPAC name of 2-aminoethanesulfonate;tetrabutylazanium (CID 18413528) is 2-aminoethanesulfonate;tetrabutylazanium.
What is the SMILES notation for 2-aminoethanesulfonate;tetrabutylazanium?
The canonical SMILES for 2-aminoethanesulfonate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.NCCS(=O)(=O)[O-].
What is the InChIKey of 2-aminoethanesulfonate;tetrabutylazanium?
The InChIKey is YWLHQBNWPCKZSB-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.C2H7NO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;3-1-2-7(4,5)6/h5-16H2,1-4H3;1-3H2,(H,4,5,6)/q+1;/p-1.
What are the key properties of 2-aminoethanesulfonate;tetrabutylazanium?
2-aminoethanesulfonate;tetrabutylazanium has a molecular weight of 366.61 g/mol, XLogP of 3.49, 14 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethanesulfonate;tetrabutylazanium is sourced from PubChem (CID 18413528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).