About 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine
1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine (PubChem CID 18413760) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine.
Molecular Properties
| Compound Name | 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine |
| PubChem CID | 18413760 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine |
| SMILES | C=C(OC(=C)N(C)C)N(C)C |
| InChI | InChI=1S/C8H16N2O/c1-7(9(3)4)11-8(2)10(5)6/h1-2H2,3-6H3 |
| InChIKey | MKTPUPOVXIJFEX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine?
The IUPAC name of 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine (CID 18413760) is 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine.
What is the SMILES notation for 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine?
The canonical SMILES for 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine is C=C(OC(=C)N(C)C)N(C)C.
What is the InChIKey of 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine?
The InChIKey is MKTPUPOVXIJFEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(9(3)4)11-8(2)10(5)6/h1-2H2,3-6H3.
What are the key properties of 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine?
1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine has a molecular weight of 156.23 g/mol, XLogP of 1.07, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(dimethylamino)ethenoxy]-N,N-dimethylethenamine is sourced from PubChem (CID 18413760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).