About 1-methyl-2,3-dihydropyridin-6-one
1-methyl-2,3-dihydropyridin-6-one (PubChem CID 18414702) has the molecular formula C6H9NO
and a molecular weight of 111.14 g/mol. Its IUPAC name is 1-methyl-2,3-dihydropyridin-6-one.
Molecular Properties
| Compound Name | 1-methyl-2,3-dihydropyridin-6-one |
| PubChem CID | 18414702 |
| Molecular Formula | C6H9NO |
| Molecular Weight | 111.14 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | 1-methyl-2,3-dihydropyridin-6-one |
| SMILES | CN1CCC=CC1=O |
| InChI | InChI=1S/C6H9NO/c1-7-5-3-2-4-6(7)8/h2,4H,3,5H2,1H3 |
| InChIKey | HZNHVKIJLRXCOQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.14 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-methyl-2,3-dihydropyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-dihydropyridin-6-one?
The IUPAC name of 1-methyl-2,3-dihydropyridin-6-one (CID 18414702) is 1-methyl-2,3-dihydropyridin-6-one.
What is the SMILES notation for 1-methyl-2,3-dihydropyridin-6-one?
The canonical SMILES for 1-methyl-2,3-dihydropyridin-6-one is CN1CCC=CC1=O.
What is the InChIKey of 1-methyl-2,3-dihydropyridin-6-one?
The InChIKey is HZNHVKIJLRXCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO/c1-7-5-3-2-4-6(7)8/h2,4H,3,5H2,1H3.
What are the key properties of 1-methyl-2,3-dihydropyridin-6-one?
1-methyl-2,3-dihydropyridin-6-one has a molecular weight of 111.14 g/mol, XLogP of 0.40, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dihydropyridin-6-one is sourced from PubChem (CID 18414702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).