About 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde
4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde (PubChem CID 18414723) has the molecular formula C8H7NO3
and a molecular weight of 165.15 g/mol. Its IUPAC name is 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde |
| PubChem CID | 18414723 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde |
| SMILES | O=Cn1cc2c(c1)C(=O)OCC2 |
| InChI | InChI=1S/C8H7NO3/c10-5-9-3-6-1-2-12-8(11)7(6)4-9/h3-5H,1-2H2 |
| InChIKey | SOVFKRAYYHQTJY-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde?
The IUPAC name of 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde (CID 18414723) is 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde.
What is the SMILES notation for 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde?
The canonical SMILES for 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde is O=Cn1cc2c(c1)C(=O)OCC2.
What is the InChIKey of 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde?
The InChIKey is SOVFKRAYYHQTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3/c10-5-9-3-6-1-2-12-8(11)7(6)4-9/h3-5H,1-2H2.
What are the key properties of 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde?
4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde has a molecular weight of 165.15 g/mol, XLogP of 0.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-6,7-dihydropyrano[3,4-c]pyrrole-2-carbaldehyde is sourced from PubChem (CID 18414723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).