trimethylsilylphosphonic acid

C3H11O3PSi — CID 18414991

IUPACtrimethylsilylphosphonic acid
SMILESC[Si](C)(C)P(=O)(O)O
InChIInChI=1S/C3H11O3PSi/c1-8(2,3)7(4,5)6/h1-3H3,(H2,4,5,6)
InChIKeyRZIDASMDISXVJT-UHFFFAOYSA-N
MW154.18 g/mol
LogP1.00
Rot. Bonds1

About trimethylsilylphosphonic acid

trimethylsilylphosphonic acid (PubChem CID 18414991) has the molecular formula C3H11O3PSi and a molecular weight of 154.18 g/mol. Its IUPAC name is trimethylsilylphosphonic acid.

Molecular Properties

Compound Nametrimethylsilylphosphonic acid
PubChem CID18414991
Molecular FormulaC3H11O3PSi
Molecular Weight154.18 g/mol
Exact Mass154.02
IUPAC Nametrimethylsilylphosphonic acid
SMILESC[Si](C)(C)P(=O)(O)O
InChIInChI=1S/C3H11O3PSi/c1-8(2,3)7(4,5)6/h1-3H3,(H2,4,5,6)
InChIKeyRZIDASMDISXVJT-UHFFFAOYSA-N
XLogP1.00
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500154.18
LogP ≤ 51.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze trimethylsilylphosphonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethylsilylphosphonic acid?
The IUPAC name of trimethylsilylphosphonic acid (CID 18414991) is trimethylsilylphosphonic acid.
What is the SMILES notation for trimethylsilylphosphonic acid?
The canonical SMILES for trimethylsilylphosphonic acid is C[Si](C)(C)P(=O)(O)O.
What is the InChIKey of trimethylsilylphosphonic acid?
The InChIKey is RZIDASMDISXVJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H11O3PSi/c1-8(2,3)7(4,5)6/h1-3H3,(H2,4,5,6).
What are the key properties of trimethylsilylphosphonic acid?
trimethylsilylphosphonic acid has a molecular weight of 154.18 g/mol, XLogP of 1.00, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilylphosphonic acid is sourced from PubChem (CID 18414991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).