C13H24Si — CID 18415073
trimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 18415073) has the molecular formula C13H24Si and a molecular weight of 208.42 g/mol. Its IUPAC name is trimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | trimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 18415073 |
| Molecular Formula | C13H24Si |
| Molecular Weight | 208.42 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | trimethyl-(2,3,4,5,5-pentamethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)(C)C([Si](C)(C)C)=C1C |
| InChI | InChI=1S/C13H24Si/c1-9-10(2)12(14(6,7)8)13(4,5)11(9)3/h1-8H3 |
| InChIKey | ZZWIHRTYUJHZLQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|