About 3-(2,5-diaminophenyl)pyridine-4-carbonitrile
3-(2,5-diaminophenyl)pyridine-4-carbonitrile (PubChem CID 18415391) has the molecular formula C12H10N4
and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-(2,5-diaminophenyl)pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 3-(2,5-diaminophenyl)pyridine-4-carbonitrile |
| PubChem CID | 18415391 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 3-(2,5-diaminophenyl)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccncc1-c1cc(N)ccc1N |
| InChI | InChI=1S/C12H10N4/c13-6-8-3-4-16-7-11(8)10-5-9(14)1-2-12(10)15/h1-5,7H,14-15H2 |
| InChIKey | DWPAXCSRTAYHTK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-diaminophenyl)pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-diaminophenyl)pyridine-4-carbonitrile?
The IUPAC name of 3-(2,5-diaminophenyl)pyridine-4-carbonitrile (CID 18415391) is 3-(2,5-diaminophenyl)pyridine-4-carbonitrile.
What is the SMILES notation for 3-(2,5-diaminophenyl)pyridine-4-carbonitrile?
The canonical SMILES for 3-(2,5-diaminophenyl)pyridine-4-carbonitrile is N#Cc1ccncc1-c1cc(N)ccc1N.
What is the InChIKey of 3-(2,5-diaminophenyl)pyridine-4-carbonitrile?
The InChIKey is DWPAXCSRTAYHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4/c13-6-8-3-4-16-7-11(8)10-5-9(14)1-2-12(10)15/h1-5,7H,14-15H2.
What are the key properties of 3-(2,5-diaminophenyl)pyridine-4-carbonitrile?
3-(2,5-diaminophenyl)pyridine-4-carbonitrile has a molecular weight of 210.24 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-diaminophenyl)pyridine-4-carbonitrile is sourced from PubChem (CID 18415391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).