C22H21Cl2N3O — CID 18415821
N-(2,5-dichloropentyl)-4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)benzamide (PubChem CID 18415821) has the molecular formula C22H21Cl2N3O and a molecular weight of 414.34 g/mol. Its IUPAC name is N-(2,5-dichloropentyl)-4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)benzamide.
| Compound Name | N-(2,5-dichloropentyl)-4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 18415821 |
| Molecular Formula | C22H21Cl2N3O |
| Molecular Weight | 414.34 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | N-(2,5-dichloropentyl)-4-(1,4-dihydroindeno[2,1-d]pyrazol-3-yl)benzamide |
| SMILES | O=C(NCC(Cl)CCCCl)c1ccc(-c2n[nH]c3c2Cc2ccccc2-3)cc1 |
| InChI | InChI=1S/C22H21Cl2N3O/c23-11-3-5-17(24)13-25-22(28)15-9-7-14(8-10-15)20-19-12-16-4-1-2-6-18(16)21(19)27-26-20/h1-2,4,6-10,17H,3,5,11-13H2,(H,25,28)(H,26,27) |
| InChIKey | NTBRWLPNIVSOQF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.34 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|