C18H18F6N2O2 — CID 18416193
2-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one (PubChem CID 18416193) has the molecular formula C18H18F6N2O2 and a molecular weight of 408.34 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one.
| Compound Name | 2-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one |
|---|---|
| PubChem CID | 18416193 |
| Molecular Formula | C18H18F6N2O2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-(2-methylpropyl)-1-(2,2,2-trifluoroethyl)-9-(trifluoromethyl)-3,6-dihydro-2H-pyrido[3,2-g][1,4]benzoxazin-7-one |
| SMILES | CC(C)CC1COc2cc3[nH]c(=O)cc(C(F)(F)F)c3cc2N1CC(F)(F)F |
| InChI | InChI=1S/C18H18F6N2O2/c1-9(2)3-10-7-28-15-6-13-11(4-14(15)26(10)8-17(19,20)21)12(18(22,23)24)5-16(27)25-13/h4-6,9-10H,3,7-8H2,1-2H3,(H,25,27) |
| InChIKey | VBNOPZVOGBGCQR-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |