About pyrido[2,3-g]quinoxaline-2,7-dione
pyrido[2,3-g]quinoxaline-2,7-dione (PubChem CID 18416205) has the molecular formula C11H5N3O2
and a molecular weight of 211.18 g/mol. Its IUPAC name is pyrido[2,3-g]quinoxaline-2,7-dione.
Molecular Properties
| Compound Name | pyrido[2,3-g]quinoxaline-2,7-dione |
| PubChem CID | 18416205 |
| Molecular Formula | C11H5N3O2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | pyrido[2,3-g]quinoxaline-2,7-dione |
| SMILES | O=C1C=Cc2cc3c(cc2=N1)N=CC(=O)N=3 |
| InChI | InChI=1S/C11H5N3O2/c15-10-2-1-6-3-9-8(4-7(6)13-10)12-5-11(16)14-9/h1-5H |
| InChIKey | QSZIYOZIPNVTDA-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 71.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze pyrido[2,3-g]quinoxaline-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrido[2,3-g]quinoxaline-2,7-dione?
The IUPAC name of pyrido[2,3-g]quinoxaline-2,7-dione (CID 18416205) is pyrido[2,3-g]quinoxaline-2,7-dione.
What is the SMILES notation for pyrido[2,3-g]quinoxaline-2,7-dione?
The canonical SMILES for pyrido[2,3-g]quinoxaline-2,7-dione is O=C1C=Cc2cc3c(cc2=N1)N=CC(=O)N=3.
What is the InChIKey of pyrido[2,3-g]quinoxaline-2,7-dione?
The InChIKey is QSZIYOZIPNVTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5N3O2/c15-10-2-1-6-3-9-8(4-7(6)13-10)12-5-11(16)14-9/h1-5H.
What are the key properties of pyrido[2,3-g]quinoxaline-2,7-dione?
pyrido[2,3-g]quinoxaline-2,7-dione has a molecular weight of 211.18 g/mol, XLogP of -0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrido[2,3-g]quinoxaline-2,7-dione is sourced from PubChem (CID 18416205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).