About azepane-2,3,4-triol
azepane-2,3,4-triol (PubChem CID 18417369) has the molecular formula C6H13NO3
and a molecular weight of 147.17 g/mol. Its IUPAC name is azepane-2,3,4-triol.
Molecular Properties
| Compound Name | azepane-2,3,4-triol |
| PubChem CID | 18417369 |
| Molecular Formula | C6H13NO3 |
| Molecular Weight | 147.17 g/mol |
| Exact Mass | 147.09 |
| IUPAC Name | azepane-2,3,4-triol |
| SMILES | OC1CCCNC(O)C1O |
| InChI | InChI=1S/C6H13NO3/c8-4-2-1-3-7-6(10)5(4)9/h4-10H,1-3H2 |
| InChIKey | PSGFKSNFPJOSDR-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.17 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azepane-2,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepane-2,3,4-triol?
The IUPAC name of azepane-2,3,4-triol (CID 18417369) is azepane-2,3,4-triol.
What is the SMILES notation for azepane-2,3,4-triol?
The canonical SMILES for azepane-2,3,4-triol is OC1CCCNC(O)C1O.
What is the InChIKey of azepane-2,3,4-triol?
The InChIKey is PSGFKSNFPJOSDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c8-4-2-1-3-7-6(10)5(4)9/h4-10H,1-3H2.
What are the key properties of azepane-2,3,4-triol?
azepane-2,3,4-triol has a molecular weight of 147.17 g/mol, XLogP of -1.59, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azepane-2,3,4-triol is sourced from PubChem (CID 18417369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).