About 1-ethenyl-3-methylurea
1-ethenyl-3-methylurea (PubChem CID 18417868) has the molecular formula C4H8N2O
and a molecular weight of 100.12 g/mol. Its IUPAC name is 1-ethenyl-3-methylurea.
Molecular Properties
| Compound Name | 1-ethenyl-3-methylurea |
| PubChem CID | 18417868 |
| Molecular Formula | C4H8N2O |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.06 |
| IUPAC Name | 1-ethenyl-3-methylurea |
| SMILES | C=CNC(=O)NC |
| InChI | InChI=1S/C4H8N2O/c1-3-6-4(7)5-2/h3H,1H2,2H3,(H2,5,6,7) |
| InChIKey | MKIAHTYUZVGHKU-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-3-methylurea?
The IUPAC name of 1-ethenyl-3-methylurea (CID 18417868) is 1-ethenyl-3-methylurea.
What is the SMILES notation for 1-ethenyl-3-methylurea?
The canonical SMILES for 1-ethenyl-3-methylurea is C=CNC(=O)NC.
What is the InChIKey of 1-ethenyl-3-methylurea?
The InChIKey is MKIAHTYUZVGHKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O/c1-3-6-4(7)5-2/h3H,1H2,2H3,(H2,5,6,7).
What are the key properties of 1-ethenyl-3-methylurea?
1-ethenyl-3-methylurea has a molecular weight of 100.12 g/mol, XLogP of 0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-methylurea is sourced from PubChem (CID 18417868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).