About 1-ethenyl-1,3-dimethylurea
1-ethenyl-1,3-dimethylurea (PubChem CID 18417869) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 1-ethenyl-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-ethenyl-1,3-dimethylurea |
| PubChem CID | 18417869 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 1-ethenyl-1,3-dimethylurea |
| SMILES | C=CN(C)C(=O)NC |
| InChI | InChI=1S/C5H10N2O/c1-4-7(3)5(8)6-2/h4H,1H2,2-3H3,(H,6,8) |
| InChIKey | LJKRXFYAKVYSDK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-1,3-dimethylurea?
The IUPAC name of 1-ethenyl-1,3-dimethylurea (CID 18417869) is 1-ethenyl-1,3-dimethylurea.
What is the SMILES notation for 1-ethenyl-1,3-dimethylurea?
The canonical SMILES for 1-ethenyl-1,3-dimethylurea is C=CN(C)C(=O)NC.
What is the InChIKey of 1-ethenyl-1,3-dimethylurea?
The InChIKey is LJKRXFYAKVYSDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-4-7(3)5(8)6-2/h4H,1H2,2-3H3,(H,6,8).
What are the key properties of 1-ethenyl-1,3-dimethylurea?
1-ethenyl-1,3-dimethylurea has a molecular weight of 114.15 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-1,3-dimethylurea is sourced from PubChem (CID 18417869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).