About trimethoxy(1,1,1-trifluorobutan-2-yl)silane
trimethoxy(1,1,1-trifluorobutan-2-yl)silane (PubChem CID 18417922) has the molecular formula C7H15F3O3Si
and a molecular weight of 232.27 g/mol. Its IUPAC name is trimethoxy(1,1,1-trifluorobutan-2-yl)silane.
Molecular Properties
| Compound Name | trimethoxy(1,1,1-trifluorobutan-2-yl)silane |
| PubChem CID | 18417922 |
| Molecular Formula | C7H15F3O3Si |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | trimethoxy(1,1,1-trifluorobutan-2-yl)silane |
| SMILES | CCC(C(F)(F)F)[Si](OC)(OC)OC |
| InChI | InChI=1S/C7H15F3O3Si/c1-5-6(7(8,9)10)14(11-2,12-3)13-4/h6H,5H2,1-4H3 |
| InChIKey | YPLXELNMPVKOEE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxy(1,1,1-trifluorobutan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxy(1,1,1-trifluorobutan-2-yl)silane?
The IUPAC name of trimethoxy(1,1,1-trifluorobutan-2-yl)silane (CID 18417922) is trimethoxy(1,1,1-trifluorobutan-2-yl)silane.
What is the SMILES notation for trimethoxy(1,1,1-trifluorobutan-2-yl)silane?
The canonical SMILES for trimethoxy(1,1,1-trifluorobutan-2-yl)silane is CCC(C(F)(F)F)[Si](OC)(OC)OC.
What is the InChIKey of trimethoxy(1,1,1-trifluorobutan-2-yl)silane?
The InChIKey is YPLXELNMPVKOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15F3O3Si/c1-5-6(7(8,9)10)14(11-2,12-3)13-4/h6H,5H2,1-4H3.
What are the key properties of trimethoxy(1,1,1-trifluorobutan-2-yl)silane?
trimethoxy(1,1,1-trifluorobutan-2-yl)silane has a molecular weight of 232.27 g/mol, XLogP of 2.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxy(1,1,1-trifluorobutan-2-yl)silane is sourced from PubChem (CID 18417922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).