C31H32O6S — CID 18418096
3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoic acid (PubChem CID 18418096) has the molecular formula C31H32O6S and a molecular weight of 532.66 g/mol. Its IUPAC name is 3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoic acid.
| Compound Name | 3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoic acid |
|---|---|
| PubChem CID | 18418096 |
| Molecular Formula | C31H32O6S |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 3-[2,2-dimethyl-4,6-dioxo-5-(3-tritylsulfanylpropyl)-1,3-dioxan-5-yl]propanoic acid |
| SMILES | CC1(C)OC(=O)C(CCCSC(c2ccccc2)(c2ccccc2)c2ccccc2)(CCC(=O)O)C(=O)O1 |
| InChI | InChI=1S/C31H32O6S/c1-29(2)36-27(34)30(28(35)37-29,21-19-26(32)33)20-12-22-38-31(23-13-6-3-7-14-23,24-15-8-4-9-16-24)25-17-10-5-11-18-25/h3-11,13-18H,12,19-22H2,1-2H3,(H,32,33) |
| InChIKey | CUDCDQSQUATGSM-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|