C29H24N6O3 — CID 18419168
3-[5-[[3-(aminomethyl)phenyl]methyl]-[1,3]dioxolo[4,5-f]indol-7-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one (PubChem CID 18419168) has the molecular formula C29H24N6O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is 3-[5-[[3-(aminomethyl)phenyl]methyl]-[1,3]dioxolo[4,5-f]indol-7-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one.
| Compound Name | 3-[5-[[3-(aminomethyl)phenyl]methyl]-[1,3]dioxolo[4,5-f]indol-7-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one |
|---|---|
| PubChem CID | 18419168 |
| Molecular Formula | C29H24N6O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | 3-[5-[[3-(aminomethyl)phenyl]methyl]-[1,3]dioxolo[4,5-f]indol-7-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one |
| SMILES | Cc1nc2cc3nc(-c4cn(Cc5cccc(CN)c5)c5cc6c(cc45)OCO6)c(=O)[nH]c3cc2nc1C |
| InChI | InChI=1S/C29H24N6O3/c1-15-16(2)32-22-9-24-23(8-21(22)31-15)33-28(29(36)34-24)20-13-35(12-18-5-3-4-17(6-18)11-30)25-10-27-26(7-19(20)25)37-14-38-27/h3-10,13H,11-12,14,30H2,1-2H3,(H,34,36) |
| InChIKey | ZJUGOOAZFWXWAR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 120.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|