C26H29N5O4 — CID 18419279
acetic acid;6-acetyl-2-[1-(4-aminobutyl)indol-3-yl]-7,8-dihydro-4H-pyrrolo[3,2-g]quinoxalin-3-one (PubChem CID 18419279) has the molecular formula C26H29N5O4 and a molecular weight of 475.55 g/mol. Its IUPAC name is acetic acid;6-acetyl-2-[1-(4-aminobutyl)indol-3-yl]-7,8-dihydro-4H-pyrrolo[3,2-g]quinoxalin-3-one.
| Compound Name | acetic acid;6-acetyl-2-[1-(4-aminobutyl)indol-3-yl]-7,8-dihydro-4H-pyrrolo[3,2-g]quinoxalin-3-one |
|---|---|
| PubChem CID | 18419279 |
| Molecular Formula | C26H29N5O4 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | acetic acid;6-acetyl-2-[1-(4-aminobutyl)indol-3-yl]-7,8-dihydro-4H-pyrrolo[3,2-g]quinoxalin-3-one |
| SMILES | CC(=O)N1CCc2cc3nc(-c4cn(CCCCN)c5ccccc45)c(=O)[nH]c3cc21.CC(=O)O |
| InChI | InChI=1S/C24H25N5O2.C2H4O2/c1-15(30)29-11-8-16-12-19-20(13-22(16)29)27-24(31)23(26-19)18-14-28(10-5-4-9-25)21-7-3-2-6-17(18)21;1-2(3)4/h2-3,6-7,12-14H,4-5,8-11,25H2,1H3,(H,27,31);1H3,(H,3,4) |
| InChIKey | AUVYVJNOXCNSHK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|