C28H24N6O — CID 18419285
3-[1-[[4-(aminomethyl)phenyl]methyl]indol-3-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one (PubChem CID 18419285) has the molecular formula C28H24N6O and a molecular weight of 460.54 g/mol. Its IUPAC name is 3-[1-[[4-(aminomethyl)phenyl]methyl]indol-3-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one.
| Compound Name | 3-[1-[[4-(aminomethyl)phenyl]methyl]indol-3-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one |
|---|---|
| PubChem CID | 18419285 |
| Molecular Formula | C28H24N6O |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 3-[1-[[4-(aminomethyl)phenyl]methyl]indol-3-yl]-7,8-dimethyl-1H-pyrazino[2,3-g]quinoxalin-2-one |
| SMILES | Cc1nc2cc3nc(-c4cn(Cc5ccc(CN)cc5)c5ccccc45)c(=O)[nH]c3cc2nc1C |
| InChI | InChI=1S/C28H24N6O/c1-16-17(2)31-23-12-25-24(11-22(23)30-16)32-27(28(35)33-25)21-15-34(26-6-4-3-5-20(21)26)14-19-9-7-18(13-29)8-10-19/h3-12,15H,13-14,29H2,1-2H3,(H,33,35) |
| InChIKey | JGUJEWCJQNUARU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 102.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|