C26H24N4O5 — CID 18419297
acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4H-benzo[f]quinoxalin-3-one (PubChem CID 18419297) has the molecular formula C26H24N4O5 and a molecular weight of 472.50 g/mol. Its IUPAC name is acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4H-benzo[f]quinoxalin-3-one.
| Compound Name | acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4H-benzo[f]quinoxalin-3-one |
|---|---|
| PubChem CID | 18419297 |
| Molecular Formula | C26H24N4O5 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | acetic acid;2-[5-(3-aminopropyl)-[1,3]dioxolo[4,5-f]indol-7-yl]-4H-benzo[f]quinoxalin-3-one |
| SMILES | CC(=O)O.NCCCn1cc(-c2nc3c(ccc4ccccc43)[nH]c2=O)c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C24H20N4O3.C2H4O2/c25-8-3-9-28-12-17(16-10-20-21(11-19(16)28)31-13-30-20)23-24(29)26-18-7-6-14-4-1-2-5-15(14)22(18)27-23;1-2(3)4/h1-2,4-7,10-12H,3,8-9,13,25H2,(H,26,29);1H3,(H,3,4) |
| InChIKey | HKCGXXMNXRCVGS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|