C32H34N4O3 — CID 18419301
acetic acid;2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one (PubChem CID 18419301) has the molecular formula C32H34N4O3 and a molecular weight of 522.65 g/mol. Its IUPAC name is acetic acid;2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one.
| Compound Name | acetic acid;2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one |
|---|---|
| PubChem CID | 18419301 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | acetic acid;2-[1-(4-aminobutyl)-2-benzylindol-3-yl]-4,6,7,8-tetrahydrocyclopenta[g]quinoxalin-3-one |
| SMILES | CC(=O)O.NCCCCn1c(Cc2ccccc2)c(-c2nc3cc4c(cc3[nH]c2=O)CCC4)c2ccccc21 |
| InChI | InChI=1S/C30H30N4O.C2H4O2/c31-15-6-7-16-34-26-14-5-4-13-23(26)28(27(34)17-20-9-2-1-3-10-20)29-30(35)33-25-19-22-12-8-11-21(22)18-24(25)32-29;1-2(3)4/h1-5,9-10,13-14,18-19H,6-8,11-12,15-17,31H2,(H,33,35);1H3,(H,3,4) |
| InChIKey | CGEIWEGVIRULFX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|