About 10H-pyridazino[1,2-a]diazepine
10H-pyridazino[1,2-a]diazepine (PubChem CID 18419365) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is 10H-pyridazino[1,2-a]diazepine.
Molecular Properties
| Compound Name | 10H-pyridazino[1,2-a]diazepine |
| PubChem CID | 18419365 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 10H-pyridazino[1,2-a]diazepine |
| SMILES | C1=CCN2C=CC=CN2C=C1 |
| InChI | InChI=1S/C9H10N2/c1-2-6-10-8-4-5-9-11(10)7-3-1/h1-6,8-9H,7H2 |
| InChIKey | OTZVFNQKBGMBHC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10H-pyridazino[1,2-a]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-pyridazino[1,2-a]diazepine?
The IUPAC name of 10H-pyridazino[1,2-a]diazepine (CID 18419365) is 10H-pyridazino[1,2-a]diazepine.
What is the SMILES notation for 10H-pyridazino[1,2-a]diazepine?
The canonical SMILES for 10H-pyridazino[1,2-a]diazepine is C1=CCN2C=CC=CN2C=C1.
What is the InChIKey of 10H-pyridazino[1,2-a]diazepine?
The InChIKey is OTZVFNQKBGMBHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2/c1-2-6-10-8-4-5-9-11(10)7-3-1/h1-6,8-9H,7H2.
What are the key properties of 10H-pyridazino[1,2-a]diazepine?
10H-pyridazino[1,2-a]diazepine has a molecular weight of 146.19 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-pyridazino[1,2-a]diazepine is sourced from PubChem (CID 18419365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).