C24H22F6N2O2 — CID 18419663
2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]-1H-imidazole (PubChem CID 18419663) has the molecular formula C24H22F6N2O2 and a molecular weight of 484.44 g/mol. Its IUPAC name is 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]-1H-imidazole.
| Compound Name | 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]-1H-imidazole |
|---|---|
| PubChem CID | 18419663 |
| Molecular Formula | C24H22F6N2O2 |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]-1H-imidazole |
| SMILES | CC(OC1OCCC(c2ncc[nH]2)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H22F6N2O2/c1-14(16-11-17(23(25,26)27)13-18(12-16)24(28,29)30)34-22-20(15-5-3-2-4-6-15)19(7-10-33-22)21-31-8-9-32-21/h2-6,8-9,11-14,19-20,22H,7,10H2,1H3,(H,31,32) |
| InChIKey | FFTREAACPPZYFV-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |