About 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol
2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol (PubChem CID 18419668) has the molecular formula C23H24F6O3
and a molecular weight of 462.43 g/mol. Its IUPAC name is 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol |
| PubChem CID | 18419668 |
| Molecular Formula | C23H24F6O3 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol |
| SMILES | CC(OC1OCCC(CCO)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F6O3/c1-14(17-11-18(22(24,25)26)13-19(12-17)23(27,28)29)32-21-20(15-5-3-2-4-6-15)16(7-9-30)8-10-31-21/h2-6,11-14,16,20-21,30H,7-10H2,1H3 |
| InChIKey | NWZJDAGORPLOSY-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol?
The IUPAC name of 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol (CID 18419668) is 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol.
What is the SMILES notation for 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol?
The canonical SMILES for 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol is CC(OC1OCCC(CCO)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol?
The InChIKey is NWZJDAGORPLOSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F6O3/c1-14(17-11-18(22(24,25)26)13-19(12-17)23(27,28)29)32-21-20(15-5-3-2-4-6-15)16(7-9-30)8-10-31-21/h2-6,11-14,16,20-21,30H,7-10H2,1H3.
What are the key properties of 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol?
2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol has a molecular weight of 462.43 g/mol, XLogP of 6.33, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]ethanol is sourced from PubChem (CID 18419668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).