About [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate
[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate (PubChem CID 18419687) has the molecular formula C23H24F6O5S
and a molecular weight of 526.50 g/mol. Its IUPAC name is [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate.
Molecular Properties
| Compound Name | [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate |
| PubChem CID | 18419687 |
| Molecular Formula | C23H24F6O5S |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate |
| SMILES | CC(OC1OCCC(COS(C)(=O)=O)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H24F6O5S/c1-14(17-10-18(22(24,25)26)12-19(11-17)23(27,28)29)34-21-20(15-6-4-3-5-7-15)16(8-9-32-21)13-33-35(2,30)31/h3-7,10-12,14,16,20-21H,8-9,13H2,1-2H3 |
| InChIKey | QIQYMMRRUUQFIB-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate?
The IUPAC name of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate (CID 18419687) is [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate.
What is the SMILES notation for [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate?
The canonical SMILES for [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate is CC(OC1OCCC(COS(C)(=O)=O)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate?
The InChIKey is QIQYMMRRUUQFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F6O5S/c1-14(17-10-18(22(24,25)26)12-19(11-17)23(27,28)29)34-21-20(15-6-4-3-5-7-15)16(8-9-32-21)13-33-35(2,30)31/h3-7,10-12,14,16,20-21H,8-9,13H2,1-2H3.
What are the key properties of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate?
[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate has a molecular weight of 526.50 g/mol, XLogP of 5.92, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methyl methanesulfonate is sourced from PubChem (CID 18419687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).