About [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol
[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol (PubChem CID 18419710) has the molecular formula C22H22F6O3
and a molecular weight of 448.40 g/mol. Its IUPAC name is [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol |
| PubChem CID | 18419710 |
| Molecular Formula | C22H22F6O3 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol |
| SMILES | CC(OC1OCCC(CO)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F6O3/c1-13(16-9-17(21(23,24)25)11-18(10-16)22(26,27)28)31-20-19(14-5-3-2-4-6-14)15(12-29)7-8-30-20/h2-6,9-11,13,15,19-20,29H,7-8,12H2,1H3 |
| InChIKey | QOEGRDVURRXNLN-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol?
The IUPAC name of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol (CID 18419710) is [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol.
What is the SMILES notation for [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol?
The canonical SMILES for [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol is CC(OC1OCCC(CO)C1c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol?
The InChIKey is QOEGRDVURRXNLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F6O3/c1-13(16-9-17(21(23,24)25)11-18(10-16)22(26,27)28)31-20-19(14-5-3-2-4-6-14)15(12-29)7-8-30-20/h2-6,9-11,13,15,19-20,29H,7-8,12H2,1H3.
What are the key properties of [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol?
[2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol has a molecular weight of 448.40 g/mol, XLogP of 5.94, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-phenyloxan-4-yl]methanol is sourced from PubChem (CID 18419710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).