C13H23N4O2+ — CID 18420112
cyclohexyl-(4,6-dimethoxy-1,3,5-triazin-2-yl)-dimethylazanium (PubChem CID 18420112) has the molecular formula C13H23N4O2+ and a molecular weight of 267.35 g/mol. Its IUPAC name is cyclohexyl-(4,6-dimethoxy-1,3,5-triazin-2-yl)-dimethylazanium.
| Compound Name | cyclohexyl-(4,6-dimethoxy-1,3,5-triazin-2-yl)-dimethylazanium |
|---|---|
| PubChem CID | 18420112 |
| Molecular Formula | C13H23N4O2+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | cyclohexyl-(4,6-dimethoxy-1,3,5-triazin-2-yl)-dimethylazanium |
| SMILES | COc1nc(OC)nc([N+](C)(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C13H23N4O2/c1-17(2,10-8-6-5-7-9-10)11-14-12(18-3)16-13(15-11)19-4/h10H,5-9H2,1-4H3/q+1 |
| InChIKey | JXONDGRDJPEFID-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|