C19H13NO5 — CID 18421403
2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]isoindole-1,3-dione (PubChem CID 18421403) has the molecular formula C19H13NO5 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18421403 |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[(7-hydroxy-8-methyl-2-oxochromen-4-yl)methyl]isoindole-1,3-dione |
| SMILES | Cc1c(O)ccc2c(CN3C(=O)c4ccccc4C3=O)cc(=O)oc12 |
| InChI | InChI=1S/C19H13NO5/c1-10-15(21)7-6-12-11(8-16(22)25-17(10)12)9-20-18(23)13-4-2-3-5-14(13)19(20)24/h2-8,21H,9H2,1H3 |
| InChIKey | KGSWBWADZRAKNA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|