C15H13IO3 — CID 18421443
6-(iodomethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one (PubChem CID 18421443) has the molecular formula C15H13IO3 and a molecular weight of 368.17 g/mol. Its IUPAC name is 6-(iodomethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one.
| Compound Name | 6-(iodomethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one |
|---|---|
| PubChem CID | 18421443 |
| Molecular Formula | C15H13IO3 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 367.99 |
| IUPAC Name | 6-(iodomethyl)-3,5,9-trimethylfuro[3,2-g]chromen-7-one |
| SMILES | Cc1coc2c(C)c3oc(=O)c(CI)c(C)c3cc12 |
| InChI | InChI=1S/C15H13IO3/c1-7-6-18-13-9(3)14-11(4-10(7)13)8(2)12(5-16)15(17)19-14/h4,6H,5H2,1-3H3 |
| InChIKey | HXCMIUQCYPSDLV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|